Convert compound descriptors
convert_compound_descriptor( x, target_descriptor = c("smiles", "inchi", "smarts", "inchi_key"), url = "http://127.0.0.1:8000" )
| x | A character vector of compounds, optionally named.
Assumed to be InChI. Specify descriptor explicitly or attach
pre-computed fingerprints using |
|---|---|
| target_descriptor | The chemical descriptor targeted for conversion. |
| url | URL to the lspcheminf python server |
A tibble with three columns, containing query compound names, query compound descriptor and target descriptor
convert_compound_descriptor( c( "tofacitnib" = "InChI=1S/C16H20N6O/c1-11-5-8-22(14(23)3-6-17)9-13(11)21(2)16-12-4-7-18-15(12)19-10-20-16/h4,7,10-11,13H,3,5,8-9H2,1-2H3,(H,18,19,20)/t11-,13+/m1/s1", "aspirin" = "InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)" ), target_descriptor = "smiles" )#> # A tibble: 2 x 3 #> compounds identifier names #> <chr> <chr> <chr> #> 1 C[C@@H]1CCN(C(=O)CC#N)C[C@@H]1N(C)c1ncnc2[nH]ccc12 smiles tofacitnib #> 2 CC(=O)Oc1ccccc1C(=O)O smiles aspirin