Establish identity between compounds using both morgan and topological fingerprints and molecular weight.
compound_identity(query, target = NULL, url = "http://127.0.0.1:8000")
| query | A character vector of compounds, optionally named.
Assumed to be InChI. Specify descriptor explicitly using |
|---|---|
| target | A character vector of compounds like |
| url | URL to the lspcheminf python server |
Requires chemfp installed on the python server.
compound_identity( c("resveratrol" = "InChI=1S/C14H12O3/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h1-9,15-17H/b2-1+"), c( "tofacitnib" = "InChI=1S/C16H20N6O/c1-11-5-8-22(14(23)3-6-17)9-13(11)21(2)16-12-4-7-18-15(12)19-10-20-16/h4,7,10-11,13H,3,5,8-9H2,1-2H3,(H,18,19,20)/t11-,13+/m1/s1", "aspirin" = "InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)", "resveratrol2" = "InChI=1S/C14H12O3/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h1-9,15-17H/b2-1+" ) )#> # A tibble: 1 x 2 #> query target #> <chr> <chr> #> 1 resveratrol resveratrol2